C16H23BrN4O3S — CID 111141413
N-(4-bromophenyl)-3-[[[(1,1-dioxothiolan-3-yl)amino]-(ethylamino)methylidene]amino]propanamide (PubChem CID 111141413) has the molecular formula C16H23BrN4O3S and a molecular weight of 431.36 g/mol. Its IUPAC name is N-(4-bromophenyl)-3-[[[(1,1-dioxothiolan-3-yl)amino]-(ethylamino)methylidene]amino]propanamide.
| Compound Name | N-(4-bromophenyl)-3-[[[(1,1-dioxothiolan-3-yl)amino]-(ethylamino)methylidene]amino]propanamide |
|---|---|
| PubChem CID | 111141413 |
| Molecular Formula | C16H23BrN4O3S |
| Molecular Weight | 431.36 g/mol |
| Exact Mass | 430.07 |
| IUPAC Name | N-(4-bromophenyl)-3-[[[(1,1-dioxothiolan-3-yl)amino]-(ethylamino)methylidene]amino]propanamide |
| SMILES | CCN/C(=N\CCC(=O)Nc1ccc(Br)cc1)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H23BrN4O3S/c1-2-18-16(21-14-8-10-25(23,24)11-14)19-9-7-15(22)20-13-5-3-12(17)4-6-13/h3-6,14H,2,7-11H2,1H3,(H,20,22)(H2,18,19,21) |
| InChIKey | DRQFZPVEEFZJNO-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.36 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|