C20H34IN3O2S — CID 109464809
1-[(1,1-dioxothiolan-3-yl)methyl]-3-ethyl-2-[2-(4-ethylphenyl)-2-methylpropyl]guanidine;hydroiodide (PubChem CID 109464809) has the molecular formula C20H34IN3O2S and a molecular weight of 507.48 g/mol. Its IUPAC name is 1-[(1,1-dioxothiolan-3-yl)methyl]-3-ethyl-2-[2-(4-ethylphenyl)-2-methylpropyl]guanidine;hydroiodide.
| Compound Name | 1-[(1,1-dioxothiolan-3-yl)methyl]-3-ethyl-2-[2-(4-ethylphenyl)-2-methylpropyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109464809 |
| Molecular Formula | C20H34IN3O2S |
| Molecular Weight | 507.48 g/mol |
| Exact Mass | 507.14 |
| IUPAC Name | 1-[(1,1-dioxothiolan-3-yl)methyl]-3-ethyl-2-[2-(4-ethylphenyl)-2-methylpropyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(C)c1ccc(CC)cc1)NCC1CCS(=O)(=O)C1.I |
| InChI | InChI=1S/C20H33N3O2S.HI/c1-5-16-7-9-18(10-8-16)20(3,4)15-23-19(21-6-2)22-13-17-11-12-26(24,25)14-17;/h7-10,17H,5-6,11-15H2,1-4H3,(H2,21,22,23);1H |
| InChIKey | GSQNJWXQXDMGKE-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.48 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|