C16H23F3IN3O2S — CID 111295918
1-[(1,1-dioxothiolan-3-yl)methyl]-2-methyl-3-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine;hydroiodide (PubChem CID 111295918) has the molecular formula C16H23F3IN3O2S and a molecular weight of 505.34 g/mol. Its IUPAC name is 1-[(1,1-dioxothiolan-3-yl)methyl]-2-methyl-3-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine;hydroiodide.
| Compound Name | 1-[(1,1-dioxothiolan-3-yl)methyl]-2-methyl-3-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111295918 |
| Molecular Formula | C16H23F3IN3O2S |
| Molecular Weight | 505.34 g/mol |
| Exact Mass | 505.05 |
| IUPAC Name | 1-[(1,1-dioxothiolan-3-yl)methyl]-2-methyl-3-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1ccc(C(F)(F)F)cc1)NCC1CCS(=O)(=O)C1.I |
| InChI | InChI=1S/C16H22F3N3O2S.HI/c1-20-15(22-10-13-7-9-25(23,24)11-13)21-8-6-12-2-4-14(5-3-12)16(17,18)19;/h2-5,13H,6-11H2,1H3,(H2,20,21,22);1H |
| InChIKey | USWLPKHVXIYGPT-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.34 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|