C15H30IN3O2S — CID 111946966
1-(3-cyclopentylpropyl)-3-[(1,1-dioxothiolan-3-yl)methyl]-2-methylguanidine;hydroiodide (PubChem CID 111946966) has the molecular formula C15H30IN3O2S and a molecular weight of 443.40 g/mol. Its IUPAC name is 1-(3-cyclopentylpropyl)-3-[(1,1-dioxothiolan-3-yl)methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-(3-cyclopentylpropyl)-3-[(1,1-dioxothiolan-3-yl)methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111946966 |
| Molecular Formula | C15H30IN3O2S |
| Molecular Weight | 443.40 g/mol |
| Exact Mass | 443.11 |
| IUPAC Name | 1-(3-cyclopentylpropyl)-3-[(1,1-dioxothiolan-3-yl)methyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCCC1CCCC1)NCC1CCS(=O)(=O)C1.I |
| InChI | InChI=1S/C15H29N3O2S.HI/c1-16-15(17-9-4-7-13-5-2-3-6-13)18-11-14-8-10-21(19,20)12-14;/h13-14H,2-12H2,1H3,(H2,16,17,18);1H |
| InChIKey | HUKJJUMSVLGHLA-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.40 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|