C17H36IN3O2S — CID 111573620
1-(2-tert-butylsulfonylethyl)-3-(3-cyclohexylpropyl)-2-methylguanidine;hydroiodide (PubChem CID 111573620) has the molecular formula C17H36IN3O2S and a molecular weight of 473.47 g/mol. Its IUPAC name is 1-(2-tert-butylsulfonylethyl)-3-(3-cyclohexylpropyl)-2-methylguanidine;hydroiodide.
| Compound Name | 1-(2-tert-butylsulfonylethyl)-3-(3-cyclohexylpropyl)-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111573620 |
| Molecular Formula | C17H36IN3O2S |
| Molecular Weight | 473.47 g/mol |
| Exact Mass | 473.16 |
| IUPAC Name | 1-(2-tert-butylsulfonylethyl)-3-(3-cyclohexylpropyl)-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCCCC1CCCCC1)NCCS(=O)(=O)C(C)(C)C.I |
| InChI | InChI=1S/C17H35N3O2S.HI/c1-17(2,3)23(21,22)14-13-20-16(18-4)19-12-8-11-15-9-6-5-7-10-15;/h15H,5-14H2,1-4H3,(H2,18,19,20);1H |
| InChIKey | UZIHSGHNXWWMPG-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.47 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|