C14H29N3 — CID 111151166
1-butyl-3-(2-cyclohexylethyl)-2-methylguanidine (PubChem CID 111151166) has the molecular formula C14H29N3 and a molecular weight of 239.41 g/mol. Its IUPAC name is 1-butyl-3-(2-cyclohexylethyl)-2-methylguanidine.
| Compound Name | 1-butyl-3-(2-cyclohexylethyl)-2-methylguanidine |
|---|---|
| PubChem CID | 111151166 |
| Molecular Formula | C14H29N3 |
| Molecular Weight | 239.41 g/mol |
| Exact Mass | 239.24 |
| IUPAC Name | 1-butyl-3-(2-cyclohexylethyl)-2-methylguanidine |
| SMILES | CCCCN/C(=N\C)NCCC1CCCCC1 |
| InChI | InChI=1S/C14H29N3/c1-3-4-11-16-14(15-2)17-12-10-13-8-6-5-7-9-13/h13H,3-12H2,1-2H3,(H2,15,16,17) |
| InChIKey | CTMMOINTGFMMBZ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.41 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|