C14H30IN3 — CID 110944229
1-butan-2-yl-3-(3-cyclopentylpropyl)-2-methylguanidine;hydroiodide (PubChem CID 110944229) has the molecular formula C14H30IN3 and a molecular weight of 367.32 g/mol. Its IUPAC name is 1-butan-2-yl-3-(3-cyclopentylpropyl)-2-methylguanidine;hydroiodide.
| Compound Name | 1-butan-2-yl-3-(3-cyclopentylpropyl)-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110944229 |
| Molecular Formula | C14H30IN3 |
| Molecular Weight | 367.32 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 1-butan-2-yl-3-(3-cyclopentylpropyl)-2-methylguanidine;hydroiodide |
| SMILES | CCC(C)N/C(=N\C)NCCCC1CCCC1.I |
| InChI | InChI=1S/C14H29N3.HI/c1-4-12(2)17-14(15-3)16-11-7-10-13-8-5-6-9-13;/h12-13H,4-11H2,1-3H3,(H2,15,16,17);1H |
| InChIKey | ASHBNFKBWGRWRE-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.32 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|