C13H29N3O — CID 110944688
1-butan-2-yl-3-(3-butoxypropyl)-2-methylguanidine (PubChem CID 110944688) has the molecular formula C13H29N3O and a molecular weight of 243.39 g/mol. Its IUPAC name is 1-butan-2-yl-3-(3-butoxypropyl)-2-methylguanidine.
| Compound Name | 1-butan-2-yl-3-(3-butoxypropyl)-2-methylguanidine |
|---|---|
| PubChem CID | 110944688 |
| Molecular Formula | C13H29N3O |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.23 |
| IUPAC Name | 1-butan-2-yl-3-(3-butoxypropyl)-2-methylguanidine |
| SMILES | CCCCOCCCN/C(=N\C)NC(C)CC |
| InChI | InChI=1S/C13H29N3O/c1-5-7-10-17-11-8-9-15-13(14-4)16-12(3)6-2/h12H,5-11H2,1-4H3,(H2,14,15,16) |
| InChIKey | OUPBDLADMVMMDN-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|