C10H23N3O — CID 110914191
1-(3-butoxypropyl)-2,3-dimethylguanidine (PubChem CID 110914191) has the molecular formula C10H23N3O and a molecular weight of 201.31 g/mol. Its IUPAC name is 1-(3-butoxypropyl)-2,3-dimethylguanidine.
| Compound Name | 1-(3-butoxypropyl)-2,3-dimethylguanidine |
|---|---|
| PubChem CID | 110914191 |
| Molecular Formula | C10H23N3O |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.18 |
| IUPAC Name | 1-(3-butoxypropyl)-2,3-dimethylguanidine |
| SMILES | CCCCOCCCN/C(=N/C)NC |
| InChI | InChI=1S/C10H23N3O/c1-4-5-8-14-9-6-7-13-10(11-2)12-3/h4-9H2,1-3H3,(H2,11,12,13) |
| InChIKey | QDSJNEYCDLFHHS-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|