C14H28F3N3O2 — CID 111238925
1-(3-butoxypropyl)-2-methyl-3-[3-(2,2,2-trifluoroethoxy)propyl]guanidine (PubChem CID 111238925) has the molecular formula C14H28F3N3O2 and a molecular weight of 327.39 g/mol. Its IUPAC name is 1-(3-butoxypropyl)-2-methyl-3-[3-(2,2,2-trifluoroethoxy)propyl]guanidine.
| Compound Name | 1-(3-butoxypropyl)-2-methyl-3-[3-(2,2,2-trifluoroethoxy)propyl]guanidine |
|---|---|
| PubChem CID | 111238925 |
| Molecular Formula | C14H28F3N3O2 |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.21 |
| IUPAC Name | 1-(3-butoxypropyl)-2-methyl-3-[3-(2,2,2-trifluoroethoxy)propyl]guanidine |
| SMILES | CCCCOCCCN/C(=N\C)NCCCOCC(F)(F)F |
| InChI | InChI=1S/C14H28F3N3O2/c1-3-4-9-21-10-5-7-19-13(18-2)20-8-6-11-22-12-14(15,16)17/h3-12H2,1-2H3,(H2,18,19,20) |
| InChIKey | CGSOXVRUKFRZCB-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|