C14H29F3IN3O2 — CID 111971083
2-methyl-1-[2-(3-methylbutoxy)ethyl]-3-[3-(2,2,2-trifluoroethoxy)propyl]guanidine;hydroiodide (PubChem CID 111971083) has the molecular formula C14H29F3IN3O2 and a molecular weight of 455.30 g/mol. Its IUPAC name is 2-methyl-1-[2-(3-methylbutoxy)ethyl]-3-[3-(2,2,2-trifluoroethoxy)propyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[2-(3-methylbutoxy)ethyl]-3-[3-(2,2,2-trifluoroethoxy)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111971083 |
| Molecular Formula | C14H29F3IN3O2 |
| Molecular Weight | 455.30 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | 2-methyl-1-[2-(3-methylbutoxy)ethyl]-3-[3-(2,2,2-trifluoroethoxy)propyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCCOCC(F)(F)F)NCCOCCC(C)C.I |
| InChI | InChI=1S/C14H28F3N3O2.HI/c1-12(2)5-9-21-10-7-20-13(18-3)19-6-4-8-22-11-14(15,16)17;/h12H,4-11H2,1-3H3,(H2,18,19,20);1H |
| InChIKey | MAWFQYJKVYOUIA-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.30 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|