C18H35N3 — CID 89443004
3-butyl-1,1-dicyclohexyl-2-methylguanidine (PubChem CID 89443004) has the molecular formula C18H35N3 and a molecular weight of 293.50 g/mol. Its IUPAC name is 3-butyl-1,1-dicyclohexyl-2-methylguanidine.
| Compound Name | 3-butyl-1,1-dicyclohexyl-2-methylguanidine |
|---|---|
| PubChem CID | 89443004 |
| Molecular Formula | C18H35N3 |
| Molecular Weight | 293.50 g/mol |
| Exact Mass | 293.28 |
| IUPAC Name | 3-butyl-1,1-dicyclohexyl-2-methylguanidine |
| SMILES | CCCCN/C(=N\C)N(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C18H35N3/c1-3-4-15-20-18(19-2)21(16-11-7-5-8-12-16)17-13-9-6-10-14-17/h16-17H,3-15H2,1-2H3,(H,19,20) |
| InChIKey | KFSSZKAOYLUCMQ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.50 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|