C11H26IN3O — CID 111239932
3-(3-butoxypropyl)-1,1,2-trimethylguanidine;hydroiodide (PubChem CID 111239932) has the molecular formula C11H26IN3O and a molecular weight of 343.25 g/mol. Its IUPAC name is 3-(3-butoxypropyl)-1,1,2-trimethylguanidine;hydroiodide.
| Compound Name | 3-(3-butoxypropyl)-1,1,2-trimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111239932 |
| Molecular Formula | C11H26IN3O |
| Molecular Weight | 343.25 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | 3-(3-butoxypropyl)-1,1,2-trimethylguanidine;hydroiodide |
| SMILES | CCCCOCCCN/C(=N/C)N(C)C.I |
| InChI | InChI=1S/C11H25N3O.HI/c1-5-6-9-15-10-7-8-13-11(12-2)14(3)4;/h5-10H2,1-4H3,(H,12,13);1H |
| InChIKey | AICQCPHIDLMAJG-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.25 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|