C11H26IN3O — CID 84584169
1,1,2-trimethyl-3-[3-(2-methylpropoxy)propyl]guanidine;hydroiodide (PubChem CID 84584169) has the molecular formula C11H26IN3O and a molecular weight of 343.25 g/mol. Its IUPAC name is 1,1,2-trimethyl-3-[3-(2-methylpropoxy)propyl]guanidine;hydroiodide.
| Compound Name | 1,1,2-trimethyl-3-[3-(2-methylpropoxy)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 84584169 |
| Molecular Formula | C11H26IN3O |
| Molecular Weight | 343.25 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | 1,1,2-trimethyl-3-[3-(2-methylpropoxy)propyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCCOCC(C)C)N(C)C.I |
| InChI | InChI=1S/C11H25N3O.HI/c1-10(2)9-15-8-6-7-13-11(12-3)14(4)5;/h10H,6-9H2,1-5H3,(H,12,13);1H |
| InChIKey | UHOJEFPSEPLWJW-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.25 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|