C17H30IN3O — CID 111035695
2-benzyl-1,1-dimethyl-3-[3-(2-methylpropoxy)propyl]guanidine;hydroiodide (PubChem CID 111035695) has the molecular formula C17H30IN3O and a molecular weight of 419.35 g/mol. Its IUPAC name is 2-benzyl-1,1-dimethyl-3-[3-(2-methylpropoxy)propyl]guanidine;hydroiodide.
| Compound Name | 2-benzyl-1,1-dimethyl-3-[3-(2-methylpropoxy)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111035695 |
| Molecular Formula | C17H30IN3O |
| Molecular Weight | 419.35 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | 2-benzyl-1,1-dimethyl-3-[3-(2-methylpropoxy)propyl]guanidine;hydroiodide |
| SMILES | CC(C)COCCCN/C(=N/Cc1ccccc1)N(C)C.I |
| InChI | InChI=1S/C17H29N3O.HI/c1-15(2)14-21-12-8-11-18-17(20(3)4)19-13-16-9-6-5-7-10-16;/h5-7,9-10,15H,8,11-14H2,1-4H3,(H,18,19);1H |
| InChIKey | PMJLPTAEHBQKGU-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.35 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|