C15H22F3N3O — CID 111057756
2-benzyl-1,1-dimethyl-3-[3-(2,2,2-trifluoroethoxy)propyl]guanidine (PubChem CID 111057756) has the molecular formula C15H22F3N3O and a molecular weight of 317.35 g/mol. Its IUPAC name is 2-benzyl-1,1-dimethyl-3-[3-(2,2,2-trifluoroethoxy)propyl]guanidine.
| Compound Name | 2-benzyl-1,1-dimethyl-3-[3-(2,2,2-trifluoroethoxy)propyl]guanidine |
|---|---|
| PubChem CID | 111057756 |
| Molecular Formula | C15H22F3N3O |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | 2-benzyl-1,1-dimethyl-3-[3-(2,2,2-trifluoroethoxy)propyl]guanidine |
| SMILES | CN(C)/C(=N\Cc1ccccc1)NCCCOCC(F)(F)F |
| InChI | InChI=1S/C15H22F3N3O/c1-21(2)14(20-11-13-7-4-3-5-8-13)19-9-6-10-22-12-15(16,17)18/h3-5,7-8H,6,9-12H2,1-2H3,(H,19,20) |
| InChIKey | GVCKGWPHZPTHTM-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|