C19H25N3O2S — CID 111085375
3-[3-(benzenesulfonyl)propyl]-2-benzyl-1,1-dimethylguanidine (PubChem CID 111085375) has the molecular formula C19H25N3O2S and a molecular weight of 359.50 g/mol. Its IUPAC name is 3-[3-(benzenesulfonyl)propyl]-2-benzyl-1,1-dimethylguanidine.
| Compound Name | 3-[3-(benzenesulfonyl)propyl]-2-benzyl-1,1-dimethylguanidine |
|---|---|
| PubChem CID | 111085375 |
| Molecular Formula | C19H25N3O2S |
| Molecular Weight | 359.50 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | 3-[3-(benzenesulfonyl)propyl]-2-benzyl-1,1-dimethylguanidine |
| SMILES | CN(C)/C(=N\Cc1ccccc1)NCCCS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H25N3O2S/c1-22(2)19(21-16-17-10-5-3-6-11-17)20-14-9-15-25(23,24)18-12-7-4-8-13-18/h3-8,10-13H,9,14-16H2,1-2H3,(H,20,21) |
| InChIKey | RDOUREWRQRLQLL-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.50 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|