C14H22IN3O2 — CID 111063956
methyl 3-[(N'-benzyl-N,N-dimethylcarbamimidoyl)amino]propanoate;hydroiodide (PubChem CID 111063956) has the molecular formula C14H22IN3O2 and a molecular weight of 391.25 g/mol. Its IUPAC name is methyl 3-[(N'-benzyl-N,N-dimethylcarbamimidoyl)amino]propanoate;hydroiodide.
| Compound Name | methyl 3-[(N'-benzyl-N,N-dimethylcarbamimidoyl)amino]propanoate;hydroiodide |
|---|---|
| PubChem CID | 111063956 |
| Molecular Formula | C14H22IN3O2 |
| Molecular Weight | 391.25 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | methyl 3-[(N'-benzyl-N,N-dimethylcarbamimidoyl)amino]propanoate;hydroiodide |
| SMILES | COC(=O)CCN/C(=N/Cc1ccccc1)N(C)C.I |
| InChI | InChI=1S/C14H21N3O2.HI/c1-17(2)14(15-10-9-13(18)19-3)16-11-12-7-5-4-6-8-12;/h4-8H,9-11H2,1-3H3,(H,15,16);1H |
| InChIKey | QSRRMHQZXCUAFS-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.25 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|