C16H26IN3O2 — CID 111025673
ethyl 4-[(N'-benzyl-N,N-dimethylcarbamimidoyl)amino]butanoate;hydroiodide (PubChem CID 111025673) has the molecular formula C16H26IN3O2 and a molecular weight of 419.31 g/mol. Its IUPAC name is ethyl 4-[(N'-benzyl-N,N-dimethylcarbamimidoyl)amino]butanoate;hydroiodide.
| Compound Name | ethyl 4-[(N'-benzyl-N,N-dimethylcarbamimidoyl)amino]butanoate;hydroiodide |
|---|---|
| PubChem CID | 111025673 |
| Molecular Formula | C16H26IN3O2 |
| Molecular Weight | 419.31 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | ethyl 4-[(N'-benzyl-N,N-dimethylcarbamimidoyl)amino]butanoate;hydroiodide |
| SMILES | CCOC(=O)CCCN/C(=N/Cc1ccccc1)N(C)C.I |
| InChI | InChI=1S/C16H25N3O2.HI/c1-4-21-15(20)11-8-12-17-16(19(2)3)18-13-14-9-6-5-7-10-14;/h5-7,9-10H,4,8,11-13H2,1-3H3,(H,17,18);1H |
| InChIKey | VGERXQSNMWBZIE-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.31 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|