C16H25FIN3O2 — CID 111285020
ethyl 4-[[N-[(3-fluorophenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]butanoate;hydroiodide (PubChem CID 111285020) has the molecular formula C16H25FIN3O2 and a molecular weight of 437.30 g/mol. Its IUPAC name is ethyl 4-[[N-[(3-fluorophenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]butanoate;hydroiodide.
| Compound Name | ethyl 4-[[N-[(3-fluorophenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]butanoate;hydroiodide |
|---|---|
| PubChem CID | 111285020 |
| Molecular Formula | C16H25FIN3O2 |
| Molecular Weight | 437.30 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | ethyl 4-[[N-[(3-fluorophenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]butanoate;hydroiodide |
| SMILES | CCOC(=O)CCCN/C(=N\C)N(C)Cc1cccc(F)c1.I |
| InChI | InChI=1S/C16H24FN3O2.HI/c1-4-22-15(21)9-6-10-19-16(18-2)20(3)12-13-7-5-8-14(17)11-13;/h5,7-8,11H,4,6,9-10,12H2,1-3H3,(H,18,19);1H |
| InChIKey | ZCLMIJYVXNPJEW-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.30 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|