C17H26FN3O2 — CID 111286057
ethyl 4-[[ethylamino-[(3-fluorophenyl)methyl-methylamino]methylidene]amino]butanoate (PubChem CID 111286057) has the molecular formula C17H26FN3O2 and a molecular weight of 323.41 g/mol. Its IUPAC name is ethyl 4-[[ethylamino-[(3-fluorophenyl)methyl-methylamino]methylidene]amino]butanoate.
| Compound Name | ethyl 4-[[ethylamino-[(3-fluorophenyl)methyl-methylamino]methylidene]amino]butanoate |
|---|---|
| PubChem CID | 111286057 |
| Molecular Formula | C17H26FN3O2 |
| Molecular Weight | 323.41 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | ethyl 4-[[ethylamino-[(3-fluorophenyl)methyl-methylamino]methylidene]amino]butanoate |
| SMILES | CCN/C(=N\CCCC(=O)OCC)N(C)Cc1cccc(F)c1 |
| InChI | InChI=1S/C17H26FN3O2/c1-4-19-17(20-11-7-10-16(22)23-5-2)21(3)13-14-8-6-9-15(18)12-14/h6,8-9,12H,4-5,7,10-11,13H2,1-3H3,(H,19,20) |
| InChIKey | DVTVZJRQJMNMDU-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.41 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|