C20H25F2IN4O — CID 111285410
3-fluoro-N-[2-[[N-[(3-fluorophenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]ethyl]-4-methylbenzamide;hydroiodide (PubChem CID 111285410) has the molecular formula C20H25F2IN4O and a molecular weight of 502.35 g/mol. Its IUPAC name is 3-fluoro-N-[2-[[N-[(3-fluorophenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]ethyl]-4-methylbenzamide;hydroiodide.
| Compound Name | 3-fluoro-N-[2-[[N-[(3-fluorophenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]ethyl]-4-methylbenzamide;hydroiodide |
|---|---|
| PubChem CID | 111285410 |
| Molecular Formula | C20H25F2IN4O |
| Molecular Weight | 502.35 g/mol |
| Exact Mass | 502.10 |
| IUPAC Name | 3-fluoro-N-[2-[[N-[(3-fluorophenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]ethyl]-4-methylbenzamide;hydroiodide |
| SMILES | C/N=C(/NCCNC(=O)c1ccc(C)c(F)c1)N(C)Cc1cccc(F)c1.I |
| InChI | InChI=1S/C20H24F2N4O.HI/c1-14-7-8-16(12-18(14)22)19(27)24-9-10-25-20(23-2)26(3)13-15-5-4-6-17(21)11-15;/h4-8,11-12H,9-10,13H2,1-3H3,(H,23,25)(H,24,27);1H |
| InChIKey | PYIRKFDCCRAKGD-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.35 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|