C17H27FN4O — CID 111159389
N-[2-[(N-butyl-N,N'-dimethylcarbamimidoyl)amino]ethyl]-3-fluoro-4-methylbenzamide (PubChem CID 111159389) has the molecular formula C17H27FN4O and a molecular weight of 322.43 g/mol. Its IUPAC name is N-[2-[(N-butyl-N,N'-dimethylcarbamimidoyl)amino]ethyl]-3-fluoro-4-methylbenzamide.
| Compound Name | N-[2-[(N-butyl-N,N'-dimethylcarbamimidoyl)amino]ethyl]-3-fluoro-4-methylbenzamide |
|---|---|
| PubChem CID | 111159389 |
| Molecular Formula | C17H27FN4O |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.22 |
| IUPAC Name | N-[2-[(N-butyl-N,N'-dimethylcarbamimidoyl)amino]ethyl]-3-fluoro-4-methylbenzamide |
| SMILES | CCCCN(C)/C(=N\C)NCCNC(=O)c1ccc(C)c(F)c1 |
| InChI | InChI=1S/C17H27FN4O/c1-5-6-11-22(4)17(19-3)21-10-9-20-16(23)14-8-7-13(2)15(18)12-14/h7-8,12H,5-6,9-11H2,1-4H3,(H,19,21)(H,20,23) |
| InChIKey | JQEDYGZLOOYJAF-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|