C12H17F2NO — CID 144686533
ethane;3-fluoro-N-(2-fluoroethyl)-4-methylbenzamide (PubChem CID 144686533) has the molecular formula C12H17F2NO and a molecular weight of 229.27 g/mol. Its IUPAC name is ethane;3-fluoro-N-(2-fluoroethyl)-4-methylbenzamide.
| Compound Name | ethane;3-fluoro-N-(2-fluoroethyl)-4-methylbenzamide |
|---|---|
| PubChem CID | 144686533 |
| Molecular Formula | C12H17F2NO |
| Molecular Weight | 229.27 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | ethane;3-fluoro-N-(2-fluoroethyl)-4-methylbenzamide |
| SMILES | CC.Cc1ccc(C(=O)NCCF)cc1F |
| InChI | InChI=1S/C10H11F2NO.C2H6/c1-7-2-3-8(6-9(7)12)10(14)13-5-4-11;1-2/h2-3,6H,4-5H2,1H3,(H,13,14);1-2H3 |
| InChIKey | SXCCSQLHUWTVDN-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.27 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |