C13H17FN2O3 — CID 35350643
3-fluoro-N-[2-[(2-methoxyacetyl)amino]ethyl]-4-methylbenzamide (PubChem CID 35350643) has the molecular formula C13H17FN2O3 and a molecular weight of 268.29 g/mol. Its IUPAC name is 3-fluoro-N-[2-[(2-methoxyacetyl)amino]ethyl]-4-methylbenzamide.
| Compound Name | 3-fluoro-N-[2-[(2-methoxyacetyl)amino]ethyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 35350643 |
| Molecular Formula | C13H17FN2O3 |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 3-fluoro-N-[2-[(2-methoxyacetyl)amino]ethyl]-4-methylbenzamide |
| SMILES | COCC(=O)NCCNC(=O)c1ccc(C)c(F)c1 |
| InChI | InChI=1S/C13H17FN2O3/c1-9-3-4-10(7-11(9)14)13(18)16-6-5-15-12(17)8-19-2/h3-4,7H,5-6,8H2,1-2H3,(H,15,17)(H,16,18) |
| InChIKey | KXYMRDFSOSZHMF-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|