C19H29FIN5O3 — CID 111163846
ethyl 4-[N-[2-[(3-fluoro-4-methylbenzoyl)amino]ethyl]-N'-methylcarbamimidoyl]piperazine-1-carboxylate;hydroiodide (PubChem CID 111163846) has the molecular formula C19H29FIN5O3 and a molecular weight of 521.38 g/mol. Its IUPAC name is ethyl 4-[N-[2-[(3-fluoro-4-methylbenzoyl)amino]ethyl]-N'-methylcarbamimidoyl]piperazine-1-carboxylate;hydroiodide.
| Compound Name | ethyl 4-[N-[2-[(3-fluoro-4-methylbenzoyl)amino]ethyl]-N'-methylcarbamimidoyl]piperazine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111163846 |
| Molecular Formula | C19H29FIN5O3 |
| Molecular Weight | 521.38 g/mol |
| Exact Mass | 521.13 |
| IUPAC Name | ethyl 4-[N-[2-[(3-fluoro-4-methylbenzoyl)amino]ethyl]-N'-methylcarbamimidoyl]piperazine-1-carboxylate;hydroiodide |
| SMILES | CCOC(=O)N1CCN(/C(=N/C)NCCNC(=O)c2ccc(C)c(F)c2)CC1.I |
| InChI | InChI=1S/C19H28FN5O3.HI/c1-4-28-19(27)25-11-9-24(10-12-25)18(21-3)23-8-7-22-17(26)15-6-5-14(2)16(20)13-15;/h5-6,13H,4,7-12H2,1-3H3,(H,21,23)(H,22,26);1H |
| InChIKey | YWSLPRLGOWNWTC-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.38 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|