C20H29FN4O — CID 109442463
N-[2-[[C-(1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-N-methylcarbonimidoyl]amino]ethyl]-3-fluoro-4-methylbenzamide (PubChem CID 109442463) has the molecular formula C20H29FN4O and a molecular weight of 360.48 g/mol. Its IUPAC name is N-[2-[[C-(1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-N-methylcarbonimidoyl]amino]ethyl]-3-fluoro-4-methylbenzamide.
| Compound Name | N-[2-[[C-(1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-N-methylcarbonimidoyl]amino]ethyl]-3-fluoro-4-methylbenzamide |
|---|---|
| PubChem CID | 109442463 |
| Molecular Formula | C20H29FN4O |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | N-[2-[[C-(1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-N-methylcarbonimidoyl]amino]ethyl]-3-fluoro-4-methylbenzamide |
| SMILES | C/N=C(\NCCNC(=O)c1ccc(C)c(F)c1)N1CC2CCCCC2C1 |
| InChI | InChI=1S/C20H29FN4O/c1-14-7-8-15(11-18(14)21)19(26)23-9-10-24-20(22-2)25-12-16-5-3-4-6-17(16)13-25/h7-8,11,16-17H,3-6,9-10,12-13H2,1-2H3,(H,22,24)(H,23,26) |
| InChIKey | OQDSLYYCGFWUSY-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|