C17H28IN5OS — CID 109443572
N-[2-[[C-(1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-N-methylcarbonimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide;hydroiodide (PubChem CID 109443572) has the molecular formula C17H28IN5OS and a molecular weight of 477.42 g/mol. Its IUPAC name is N-[2-[[C-(1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-N-methylcarbonimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide;hydroiodide.
| Compound Name | N-[2-[[C-(1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-N-methylcarbonimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 109443572 |
| Molecular Formula | C17H28IN5OS |
| Molecular Weight | 477.42 g/mol |
| Exact Mass | 477.11 |
| IUPAC Name | N-[2-[[C-(1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-N-methylcarbonimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide;hydroiodide |
| SMILES | C/N=C(\NCCNC(=O)c1scnc1C)N1CC2CCCCC2C1.I |
| InChI | InChI=1S/C17H27N5OS.HI/c1-12-15(24-11-21-12)16(23)19-7-8-20-17(18-2)22-9-13-5-3-4-6-14(13)10-22;/h11,13-14H,3-10H2,1-2H3,(H,18,20)(H,19,23);1H |
| InChIKey | UXUCRFPVKHUPAT-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.42 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|