C19H28FN5O2 — CID 110963951
N-[2-[[(4-acetylpiperazin-1-yl)-(ethylamino)methylidene]amino]ethyl]-3-fluoro-4-methylbenzamide (PubChem CID 110963951) has the molecular formula C19H28FN5O2 and a molecular weight of 377.46 g/mol. Its IUPAC name is N-[2-[[(4-acetylpiperazin-1-yl)-(ethylamino)methylidene]amino]ethyl]-3-fluoro-4-methylbenzamide.
| Compound Name | N-[2-[[(4-acetylpiperazin-1-yl)-(ethylamino)methylidene]amino]ethyl]-3-fluoro-4-methylbenzamide |
|---|---|
| PubChem CID | 110963951 |
| Molecular Formula | C19H28FN5O2 |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | N-[2-[[(4-acetylpiperazin-1-yl)-(ethylamino)methylidene]amino]ethyl]-3-fluoro-4-methylbenzamide |
| SMILES | CCN/C(=N\CCNC(=O)c1ccc(C)c(F)c1)N1CCN(C(C)=O)CC1 |
| InChI | InChI=1S/C19H28FN5O2/c1-4-21-19(25-11-9-24(10-12-25)15(3)26)23-8-7-22-18(27)16-6-5-14(2)17(20)13-16/h5-6,13H,4,7-12H2,1-3H3,(H,21,23)(H,22,27) |
| InChIKey | YRSSNBBBVBGXFC-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|