C16H25N7O2 — CID 119115877
N-[2-[[(4-acetylpiperazin-1-yl)-(ethylamino)methylidene]amino]ethyl]pyrazine-2-carboxamide (PubChem CID 119115877) has the molecular formula C16H25N7O2 and a molecular weight of 347.42 g/mol. Its IUPAC name is N-[2-[[(4-acetylpiperazin-1-yl)-(ethylamino)methylidene]amino]ethyl]pyrazine-2-carboxamide.
| Compound Name | N-[2-[[(4-acetylpiperazin-1-yl)-(ethylamino)methylidene]amino]ethyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 119115877 |
| Molecular Formula | C16H25N7O2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | N-[2-[[(4-acetylpiperazin-1-yl)-(ethylamino)methylidene]amino]ethyl]pyrazine-2-carboxamide |
| SMILES | CCN/C(=N\CCNC(=O)c1cnccn1)N1CCN(C(C)=O)CC1 |
| InChI | InChI=1S/C16H25N7O2/c1-3-18-16(23-10-8-22(9-11-23)13(2)24)21-7-6-20-15(25)14-12-17-4-5-19-14/h4-5,12H,3,6-11H2,1-2H3,(H,18,21)(H,20,25) |
| InChIKey | MLRLLJHDYDPZFJ-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 102.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|