C13H20N6O2 — CID 120661490
N-[2-[[amino-(2-methylmorpholin-4-yl)methylidene]amino]ethyl]pyrazine-2-carboxamide (PubChem CID 120661490) has the molecular formula C13H20N6O2 and a molecular weight of 292.34 g/mol. Its IUPAC name is N-[2-[[amino-(2-methylmorpholin-4-yl)methylidene]amino]ethyl]pyrazine-2-carboxamide.
| Compound Name | N-[2-[[amino-(2-methylmorpholin-4-yl)methylidene]amino]ethyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 120661490 |
| Molecular Formula | C13H20N6O2 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | N-[2-[[amino-(2-methylmorpholin-4-yl)methylidene]amino]ethyl]pyrazine-2-carboxamide |
| SMILES | CC1CN(/C(N)=N/CCNC(=O)c2cnccn2)CCO1 |
| InChI | InChI=1S/C13H20N6O2/c1-10-9-19(6-7-21-10)13(14)18-5-4-17-12(20)11-8-15-2-3-16-11/h2-3,8,10H,4-7,9H2,1H3,(H2,14,18)(H,17,20) |
| InChIKey | UNUPCNOGFASWMV-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 105.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|