C17H28N4O4Si — CID 122395103
N-[3-(3,7,10-trimethyl-2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecan-1-yl)propyl]pyrazine-2-carboxamide (PubChem CID 122395103) has the molecular formula C17H28N4O4Si and a molecular weight of 380.52 g/mol. Its IUPAC name is N-[3-(3,7,10-trimethyl-2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecan-1-yl)propyl]pyrazine-2-carboxamide.
| Compound Name | N-[3-(3,7,10-trimethyl-2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecan-1-yl)propyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 122395103 |
| Molecular Formula | C17H28N4O4Si |
| Molecular Weight | 380.52 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | N-[3-(3,7,10-trimethyl-2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecan-1-yl)propyl]pyrazine-2-carboxamide |
| SMILES | CC1CN2CC(C)O[Si](CCCNC(=O)c3cnccn3)(O1)OC(C)C2 |
| InChI | InChI=1S/C17H28N4O4Si/c1-13-10-21-11-14(2)24-26(23-13,25-15(3)12-21)8-4-5-20-17(22)16-9-18-6-7-19-16/h6-7,9,13-15H,4-5,8,10-12H2,1-3H3,(H,20,22) |
| InChIKey | MOJWRDOTDXOYBX-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.52 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|