C20H34N4O2 — CID 142959999
N-butyl-2-cyclopentylacetamide;N-butylpyrazine-2-carboxamide (PubChem CID 142959999) has the molecular formula C20H34N4O2 and a molecular weight of 362.52 g/mol. Its IUPAC name is N-butyl-2-cyclopentylacetamide;N-butylpyrazine-2-carboxamide.
| Compound Name | N-butyl-2-cyclopentylacetamide;N-butylpyrazine-2-carboxamide |
|---|---|
| PubChem CID | 142959999 |
| Molecular Formula | C20H34N4O2 |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.27 |
| IUPAC Name | N-butyl-2-cyclopentylacetamide;N-butylpyrazine-2-carboxamide |
| SMILES | CCCCNC(=O)CC1CCCC1.CCCCNC(=O)c1cnccn1 |
| InChI | InChI=1S/C11H21NO.C9H13N3O/c1-2-3-8-12-11(13)9-10-6-4-5-7-10;1-2-3-4-12-9(13)8-7-10-5-6-11-8/h10H,2-9H2,1H3,(H,12,13);5-7H,2-4H2,1H3,(H,12,13) |
| InChIKey | BWHIVHSPAIYIPW-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|