C15H23N5O4 — CID 108918789
tert-butyl N-[2-oxo-2-[3-(pyrazine-2-carbonylamino)propylamino]ethyl]carbamate (PubChem CID 108918789) has the molecular formula C15H23N5O4 and a molecular weight of 337.38 g/mol. Its IUPAC name is tert-butyl N-[2-oxo-2-[3-(pyrazine-2-carbonylamino)propylamino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-oxo-2-[3-(pyrazine-2-carbonylamino)propylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 108918789 |
| Molecular Formula | C15H23N5O4 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | tert-butyl N-[2-oxo-2-[3-(pyrazine-2-carbonylamino)propylamino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)NCCCNC(=O)c1cnccn1 |
| InChI | InChI=1S/C15H23N5O4/c1-15(2,3)24-14(23)20-10-12(21)18-5-4-6-19-13(22)11-9-16-7-8-17-11/h7-9H,4-6,10H2,1-3H3,(H,18,21)(H,19,22)(H,20,23) |
| InChIKey | HEDCAEIXULTKCH-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 122.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|