C15H23N5O5 — CID 108918758
tert-butyl N-[2-oxo-2-[3-[(6-oxo-1H-pyridazine-3-carbonyl)amino]propylamino]ethyl]carbamate (PubChem CID 108918758) has the molecular formula C15H23N5O5 and a molecular weight of 353.38 g/mol. Its IUPAC name is tert-butyl N-[2-oxo-2-[3-[(6-oxo-1H-pyridazine-3-carbonyl)amino]propylamino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-oxo-2-[3-[(6-oxo-1H-pyridazine-3-carbonyl)amino]propylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 108918758 |
| Molecular Formula | C15H23N5O5 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | tert-butyl N-[2-oxo-2-[3-[(6-oxo-1H-pyridazine-3-carbonyl)amino]propylamino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)NCCCNC(=O)c1ccc(=O)[nH]n1 |
| InChI | InChI=1S/C15H23N5O5/c1-15(2,3)25-14(24)18-9-12(22)16-7-4-8-17-13(23)10-5-6-11(21)20-19-10/h5-6H,4,7-9H2,1-3H3,(H,16,22)(H,17,23)(H,18,24)(H,20,21) |
| InChIKey | KERRBLUJCZWNHN-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 142.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|