C10H14N4O3 — CID 30539711
6-oxo-N-[2-oxo-2-(propan-2-ylamino)ethyl]-1H-pyridazine-3-carboxamide (PubChem CID 30539711) has the molecular formula C10H14N4O3 and a molecular weight of 238.25 g/mol. Its IUPAC name is 6-oxo-N-[2-oxo-2-(propan-2-ylamino)ethyl]-1H-pyridazine-3-carboxamide.
| Compound Name | 6-oxo-N-[2-oxo-2-(propan-2-ylamino)ethyl]-1H-pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 30539711 |
| Molecular Formula | C10H14N4O3 |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 6-oxo-N-[2-oxo-2-(propan-2-ylamino)ethyl]-1H-pyridazine-3-carboxamide |
| SMILES | CC(C)NC(=O)CNC(=O)c1ccc(=O)[nH]n1 |
| InChI | InChI=1S/C10H14N4O3/c1-6(2)12-9(16)5-11-10(17)7-3-4-8(15)14-13-7/h3-4,6H,5H2,1-2H3,(H,11,17)(H,12,16)(H,14,15) |
| InChIKey | SWIAJIFFBBMWHV-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |