C8H8N4O2 — CID 82281497
N-(1-cyanoethyl)-6-oxo-1H-pyridazine-3-carboxamide (PubChem CID 82281497) has the molecular formula C8H8N4O2 and a molecular weight of 192.18 g/mol. Its IUPAC name is N-(1-cyanoethyl)-6-oxo-1H-pyridazine-3-carboxamide.
| Compound Name | N-(1-cyanoethyl)-6-oxo-1H-pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 82281497 |
| Molecular Formula | C8H8N4O2 |
| Molecular Weight | 192.18 g/mol |
| Exact Mass | 192.06 |
| IUPAC Name | N-(1-cyanoethyl)-6-oxo-1H-pyridazine-3-carboxamide |
| SMILES | CC(C#N)NC(=O)c1ccc(=O)[nH]n1 |
| InChI | InChI=1S/C8H8N4O2/c1-5(4-9)10-8(14)6-2-3-7(13)12-11-6/h2-3,5H,1H3,(H,10,14)(H,12,13) |
| InChIKey | ZWDYSRWIKRTUEX-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 98.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.18 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |