C14H24N4O2 — CID 38593214
N-[(2S)-2-(diethylamino)-3-methylbutyl]-6-oxo-1H-pyridazine-3-carboxamide (PubChem CID 38593214) has the molecular formula C14H24N4O2 and a molecular weight of 280.37 g/mol. Its IUPAC name is N-[(2S)-2-(diethylamino)-3-methylbutyl]-6-oxo-1H-pyridazine-3-carboxamide.
| Compound Name | N-[(2S)-2-(diethylamino)-3-methylbutyl]-6-oxo-1H-pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 38593214 |
| Molecular Formula | C14H24N4O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | N-[(2S)-2-(diethylamino)-3-methylbutyl]-6-oxo-1H-pyridazine-3-carboxamide |
| SMILES | CCN(CC)[C@H](CNC(=O)c1ccc(=O)[nH]n1)C(C)C |
| InChI | InChI=1S/C14H24N4O2/c1-5-18(6-2)12(10(3)4)9-15-14(20)11-7-8-13(19)17-16-11/h7-8,10,12H,5-6,9H2,1-4H3,(H,15,20)(H,17,19)/t12-/m1/s1 |
| InChIKey | RJFFKNJYTDMKTD-GFCCVEGCSA-N |
| XLogP | 0.87 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |