C12H20N4O2 — CID 94182994
N-[(2R)-2-(dimethylamino)-3-methylbutyl]-6-oxo-1H-pyridazine-3-carboxamide (PubChem CID 94182994) has the molecular formula C12H20N4O2 and a molecular weight of 252.32 g/mol. Its IUPAC name is N-[(2R)-2-(dimethylamino)-3-methylbutyl]-6-oxo-1H-pyridazine-3-carboxamide.
| Compound Name | N-[(2R)-2-(dimethylamino)-3-methylbutyl]-6-oxo-1H-pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 94182994 |
| Molecular Formula | C12H20N4O2 |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | N-[(2R)-2-(dimethylamino)-3-methylbutyl]-6-oxo-1H-pyridazine-3-carboxamide |
| SMILES | CC(C)[C@H](CNC(=O)c1ccc(=O)[nH]n1)N(C)C |
| InChI | InChI=1S/C12H20N4O2/c1-8(2)10(16(3)4)7-13-12(18)9-5-6-11(17)15-14-9/h5-6,8,10H,7H2,1-4H3,(H,13,18)(H,15,17)/t10-/m0/s1 |
| InChIKey | YJQQMAMBGRMEAW-JTQLQIEISA-N |
| XLogP | 0.09 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |