C13H12ClN3O3 — CID 95967246
N-[(2R)-2-(4-chlorophenyl)-2-hydroxyethyl]-6-oxo-1H-pyridazine-3-carboxamide (PubChem CID 95967246) has the molecular formula C13H12ClN3O3 and a molecular weight of 293.71 g/mol. Its IUPAC name is N-[(2R)-2-(4-chlorophenyl)-2-hydroxyethyl]-6-oxo-1H-pyridazine-3-carboxamide.
| Compound Name | N-[(2R)-2-(4-chlorophenyl)-2-hydroxyethyl]-6-oxo-1H-pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 95967246 |
| Molecular Formula | C13H12ClN3O3 |
| Molecular Weight | 293.71 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | N-[(2R)-2-(4-chlorophenyl)-2-hydroxyethyl]-6-oxo-1H-pyridazine-3-carboxamide |
| SMILES | O=C(NC[C@H](O)c1ccc(Cl)cc1)c1ccc(=O)[nH]n1 |
| InChI | InChI=1S/C13H12ClN3O3/c14-9-3-1-8(2-4-9)11(18)7-15-13(20)10-5-6-12(19)17-16-10/h1-6,11,18H,7H2,(H,15,20)(H,17,19)/t11-/m0/s1 |
| InChIKey | VYZIFIBOVRHQAG-NSHDSACASA-N |
| XLogP | 0.89 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.71 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |