C18H15Cl2N3O2 — CID 112814117
3-(4-chlorophenyl)-N-[2-(4-chlorophenyl)-2-hydroxyethyl]-1H-pyrazole-5-carboxamide (PubChem CID 112814117) has the molecular formula C18H15Cl2N3O2 and a molecular weight of 376.24 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-N-[2-(4-chlorophenyl)-2-hydroxyethyl]-1H-pyrazole-5-carboxamide.
| Compound Name | 3-(4-chlorophenyl)-N-[2-(4-chlorophenyl)-2-hydroxyethyl]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 112814117 |
| Molecular Formula | C18H15Cl2N3O2 |
| Molecular Weight | 376.24 g/mol |
| Exact Mass | 375.05 |
| IUPAC Name | 3-(4-chlorophenyl)-N-[2-(4-chlorophenyl)-2-hydroxyethyl]-1H-pyrazole-5-carboxamide |
| SMILES | O=C(NCC(O)c1ccc(Cl)cc1)c1cc(-c2ccc(Cl)cc2)n[nH]1 |
| InChI | InChI=1S/C18H15Cl2N3O2/c19-13-5-1-11(2-6-13)15-9-16(23-22-15)18(25)21-10-17(24)12-3-7-14(20)8-4-12/h1-9,17,24H,10H2,(H,21,25)(H,22,23) |
| InChIKey | FRTJYNSPJRJITK-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.24 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |