C19H18BrN3O3 — CID 86937596
3-(4-bromophenyl)-N-[2-hydroxy-2-(3-methoxyphenyl)ethyl]-1H-pyrazole-5-carboxamide (PubChem CID 86937596) has the molecular formula C19H18BrN3O3 and a molecular weight of 416.28 g/mol. Its IUPAC name is 3-(4-bromophenyl)-N-[2-hydroxy-2-(3-methoxyphenyl)ethyl]-1H-pyrazole-5-carboxamide.
| Compound Name | 3-(4-bromophenyl)-N-[2-hydroxy-2-(3-methoxyphenyl)ethyl]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 86937596 |
| Molecular Formula | C19H18BrN3O3 |
| Molecular Weight | 416.28 g/mol |
| Exact Mass | 415.05 |
| IUPAC Name | 3-(4-bromophenyl)-N-[2-hydroxy-2-(3-methoxyphenyl)ethyl]-1H-pyrazole-5-carboxamide |
| SMILES | COc1cccc(C(O)CNC(=O)c2cc(-c3ccc(Br)cc3)n[nH]2)c1 |
| InChI | InChI=1S/C19H18BrN3O3/c1-26-15-4-2-3-13(9-15)18(24)11-21-19(25)17-10-16(22-23-17)12-5-7-14(20)8-6-12/h2-10,18,24H,11H2,1H3,(H,21,25)(H,22,23) |
| InChIKey | NYULXIWVTKAIHZ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 87.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.28 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |