C17H15BrN4O2 — CID 171675382
N-[2-(4-bromophenyl)-2-hydroxyethyl]-3-pyridin-3-yl-1H-pyrazole-5-carboxamide (PubChem CID 171675382) has the molecular formula C17H15BrN4O2 and a molecular weight of 387.24 g/mol. Its IUPAC name is N-[2-(4-bromophenyl)-2-hydroxyethyl]-3-pyridin-3-yl-1H-pyrazole-5-carboxamide.
| Compound Name | N-[2-(4-bromophenyl)-2-hydroxyethyl]-3-pyridin-3-yl-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 171675382 |
| Molecular Formula | C17H15BrN4O2 |
| Molecular Weight | 387.24 g/mol |
| Exact Mass | 386.04 |
| IUPAC Name | N-[2-(4-bromophenyl)-2-hydroxyethyl]-3-pyridin-3-yl-1H-pyrazole-5-carboxamide |
| SMILES | O=C(NCC(O)c1ccc(Br)cc1)c1cc(-c2cccnc2)n[nH]1 |
| InChI | InChI=1S/C17H15BrN4O2/c18-13-5-3-11(4-6-13)16(23)10-20-17(24)15-8-14(21-22-15)12-2-1-7-19-9-12/h1-9,16,23H,10H2,(H,20,24)(H,21,22) |
| InChIKey | OIMKJCAHXKSIIE-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.24 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |