C22H18BrN5O — CID 86906625
3-(4-bromophenyl)-N-(pyridin-3-ylmethyl)-N-(pyridin-4-ylmethyl)-1H-pyrazole-5-carboxamide (PubChem CID 86906625) has the molecular formula C22H18BrN5O and a molecular weight of 448.32 g/mol. Its IUPAC name is 3-(4-bromophenyl)-N-(pyridin-3-ylmethyl)-N-(pyridin-4-ylmethyl)-1H-pyrazole-5-carboxamide.
| Compound Name | 3-(4-bromophenyl)-N-(pyridin-3-ylmethyl)-N-(pyridin-4-ylmethyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 86906625 |
| Molecular Formula | C22H18BrN5O |
| Molecular Weight | 448.32 g/mol |
| Exact Mass | 447.07 |
| IUPAC Name | 3-(4-bromophenyl)-N-(pyridin-3-ylmethyl)-N-(pyridin-4-ylmethyl)-1H-pyrazole-5-carboxamide |
| SMILES | O=C(c1cc(-c2ccc(Br)cc2)n[nH]1)N(Cc1ccncc1)Cc1cccnc1 |
| InChI | InChI=1S/C22H18BrN5O/c23-19-5-3-18(4-6-19)20-12-21(27-26-20)22(29)28(14-16-7-10-24-11-8-16)15-17-2-1-9-25-13-17/h1-13H,14-15H2,(H,26,27) |
| InChIKey | INZSOVFZLUKYFQ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.32 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |