C19H17FN4O3 — CID 72918140
3-[[3-(2-fluorophenyl)-1H-pyrazole-5-carbonyl]-(pyridin-3-ylmethyl)amino]propanoic acid (PubChem CID 72918140) has the molecular formula C19H17FN4O3 and a molecular weight of 368.37 g/mol. Its IUPAC name is 3-[[3-(2-fluorophenyl)-1H-pyrazole-5-carbonyl]-(pyridin-3-ylmethyl)amino]propanoic acid.
| Compound Name | 3-[[3-(2-fluorophenyl)-1H-pyrazole-5-carbonyl]-(pyridin-3-ylmethyl)amino]propanoic acid |
|---|---|
| PubChem CID | 72918140 |
| Molecular Formula | C19H17FN4O3 |
| Molecular Weight | 368.37 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 3-[[3-(2-fluorophenyl)-1H-pyrazole-5-carbonyl]-(pyridin-3-ylmethyl)amino]propanoic acid |
| SMILES | O=C(O)CCN(Cc1cccnc1)C(=O)c1cc(-c2ccccc2F)n[nH]1 |
| InChI | InChI=1S/C19H17FN4O3/c20-15-6-2-1-5-14(15)16-10-17(23-22-16)19(27)24(9-7-18(25)26)12-13-4-3-8-21-11-13/h1-6,8,10-11H,7,9,12H2,(H,22,23)(H,25,26) |
| InChIKey | NFCPJEBLYIZBLF-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.37 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |