C10H8FN3O — CID 175702087
3-(2-fluorophenyl)-1H-pyrazole-5-carboxamide (PubChem CID 175702087) has the molecular formula C10H8FN3O and a molecular weight of 205.19 g/mol. Its IUPAC name is 3-(2-fluorophenyl)-1H-pyrazole-5-carboxamide.
| Compound Name | 3-(2-fluorophenyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 175702087 |
| Molecular Formula | C10H8FN3O |
| Molecular Weight | 205.19 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 3-(2-fluorophenyl)-1H-pyrazole-5-carboxamide |
| SMILES | NC(=O)c1cc(-c2ccccc2F)n[nH]1 |
| InChI | InChI=1S/C10H8FN3O/c11-7-4-2-1-3-6(7)8-5-9(10(12)15)14-13-8/h1-5H,(H2,12,15)(H,13,14) |
| InChIKey | KHVHHOUKMGBBDG-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.19 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |