C19H17FN4O2S — CID 45241409
5-[1-[3-(2-fluorophenyl)-1H-pyrazole-5-carbonyl]pyrrolidin-2-yl]thiophene-2-carboxamide (PubChem CID 45241409) has the molecular formula C19H17FN4O2S and a molecular weight of 384.44 g/mol. Its IUPAC name is 5-[1-[3-(2-fluorophenyl)-1H-pyrazole-5-carbonyl]pyrrolidin-2-yl]thiophene-2-carboxamide.
| Compound Name | 5-[1-[3-(2-fluorophenyl)-1H-pyrazole-5-carbonyl]pyrrolidin-2-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 45241409 |
| Molecular Formula | C19H17FN4O2S |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | 5-[1-[3-(2-fluorophenyl)-1H-pyrazole-5-carbonyl]pyrrolidin-2-yl]thiophene-2-carboxamide |
| SMILES | NC(=O)c1ccc(C2CCCN2C(=O)c2cc(-c3ccccc3F)n[nH]2)s1 |
| InChI | InChI=1S/C19H17FN4O2S/c20-12-5-2-1-4-11(12)13-10-14(23-22-13)19(26)24-9-3-6-15(24)16-7-8-17(27-16)18(21)25/h1-2,4-5,7-8,10,15H,3,6,9H2,(H2,21,25)(H,22,23) |
| InChIKey | SCEYGMYZTFQYBB-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |