C19H24FN3O2 — CID 96577939
[3-(2-fluorophenyl)-1H-pyrazol-5-yl]-[(2R)-2-(3-methoxypropyl)piperidin-1-yl]methanone (PubChem CID 96577939) has the molecular formula C19H24FN3O2 and a molecular weight of 345.42 g/mol. Its IUPAC name is [3-(2-fluorophenyl)-1H-pyrazol-5-yl]-[(2R)-2-(3-methoxypropyl)piperidin-1-yl]methanone.
| Compound Name | [3-(2-fluorophenyl)-1H-pyrazol-5-yl]-[(2R)-2-(3-methoxypropyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 96577939 |
| Molecular Formula | C19H24FN3O2 |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | [3-(2-fluorophenyl)-1H-pyrazol-5-yl]-[(2R)-2-(3-methoxypropyl)piperidin-1-yl]methanone |
| SMILES | COCCC[C@H]1CCCCN1C(=O)c1cc(-c2ccccc2F)n[nH]1 |
| InChI | InChI=1S/C19H24FN3O2/c1-25-12-6-8-14-7-4-5-11-23(14)19(24)18-13-17(21-22-18)15-9-2-3-10-16(15)20/h2-3,9-10,13-14H,4-8,11-12H2,1H3,(H,21,22)/t14-/m1/s1 |
| InChIKey | YLWDLUGWCDQUMQ-CQSZACIVSA-N |
| XLogP | 3.64 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|