C18H24FN3O2 — CID 97154872
(3-fluoro-5-methylimidazo[1,2-a]pyridin-2-yl)-[(2S)-2-(3-methoxypropyl)piperidin-1-yl]methanone (PubChem CID 97154872) has the molecular formula C18H24FN3O2 and a molecular weight of 333.41 g/mol. Its IUPAC name is (3-fluoro-5-methylimidazo[1,2-a]pyridin-2-yl)-[(2S)-2-(3-methoxypropyl)piperidin-1-yl]methanone.
| Compound Name | (3-fluoro-5-methylimidazo[1,2-a]pyridin-2-yl)-[(2S)-2-(3-methoxypropyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 97154872 |
| Molecular Formula | C18H24FN3O2 |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | (3-fluoro-5-methylimidazo[1,2-a]pyridin-2-yl)-[(2S)-2-(3-methoxypropyl)piperidin-1-yl]methanone |
| SMILES | COCCC[C@@H]1CCCCN1C(=O)c1nc2cccc(C)n2c1F |
| InChI | InChI=1S/C18H24FN3O2/c1-13-7-5-10-15-20-16(17(19)22(13)15)18(23)21-11-4-3-8-14(21)9-6-12-24-2/h5,7,10,14H,3-4,6,8-9,11-12H2,1-2H3/t14-/m0/s1 |
| InChIKey | QTABLZJADQBICV-AWEZNQCLSA-N |
| XLogP | 3.20 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|