C19H24N2O2 — CID 96579719
[(2R)-2-(3-methoxypropyl)piperidin-1-yl]-quinolin-6-ylmethanone (PubChem CID 96579719) has the molecular formula C19H24N2O2 and a molecular weight of 312.41 g/mol. Its IUPAC name is [(2R)-2-(3-methoxypropyl)piperidin-1-yl]-quinolin-6-ylmethanone.
| Compound Name | [(2R)-2-(3-methoxypropyl)piperidin-1-yl]-quinolin-6-ylmethanone |
|---|---|
| PubChem CID | 96579719 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | [(2R)-2-(3-methoxypropyl)piperidin-1-yl]-quinolin-6-ylmethanone |
| SMILES | COCCC[C@H]1CCCCN1C(=O)c1ccc2ncccc2c1 |
| InChI | InChI=1S/C19H24N2O2/c1-23-13-5-8-17-7-2-3-12-21(17)19(22)16-9-10-18-15(14-16)6-4-11-20-18/h4,6,9-11,14,17H,2-3,5,7-8,12-13H2,1H3/t17-/m1/s1 |
| InChIKey | WKOSTMNSLRRDED-QGZVFWFLSA-N |
| XLogP | 3.66 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|